C14H11N3 — CID 149253814
3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,4,6,8,12,14,16-heptaene (PubChem CID 149253814) has the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,4,6,8,12,14,16-heptaene.
| Compound Name | 3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,4,6,8,12,14,16-heptaene |
|---|---|
| PubChem CID | 149253814 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,4,6,8,12,14,16-heptaene |
| SMILES | C1=CC2=CC3=C4NC=CN=C4C=CN3C2C=C1 |
| InChI | InChI=1S/C14H11N3/c1-2-4-12-10(3-1)9-13-14-11(5-8-17(12)13)15-6-7-16-14/h1-9,12,16H |
| InChIKey | YXYUQWIRAQVIMA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |