C25H23N5O5S2 — CID 175665260
(2Z)-2-(benzenesulfonyl)-2-[[4-[(4,6-dimethyl-1H-triazin-2-yl)sulfonyl]phenyl]hydrazinylidene]-1-phenylethanone (PubChem CID 175665260) has the molecular formula C25H23N5O5S2 and a molecular weight of 537.62 g/mol. Its IUPAC name is (2Z)-2-(benzenesulfonyl)-2-[[4-[(4,6-dimethyl-1H-triazin-2-yl)sulfonyl]phenyl]hydrazinylidene]-1-phenylethanone.
| Compound Name | (2Z)-2-(benzenesulfonyl)-2-[[4-[(4,6-dimethyl-1H-triazin-2-yl)sulfonyl]phenyl]hydrazinylidene]-1-phenylethanone |
|---|---|
| PubChem CID | 175665260 |
| Molecular Formula | C25H23N5O5S2 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | (2Z)-2-(benzenesulfonyl)-2-[[4-[(4,6-dimethyl-1H-triazin-2-yl)sulfonyl]phenyl]hydrazinylidene]-1-phenylethanone |
| SMILES | CC1=CC(C)=NN(S(=O)(=O)c2ccc(N/N=C(/C(=O)c3ccccc3)S(=O)(=O)c3ccccc3)cc2)N1 |
| InChI | InChI=1S/C25H23N5O5S2/c1-18-17-19(2)29-30(28-18)37(34,35)23-15-13-21(14-16-23)26-27-25(24(31)20-9-5-3-6-10-20)36(32,33)22-11-7-4-8-12-22/h3-17,26,28H,1-2H3/b27-25- |
| InChIKey | UCKHMODTUKOSPC-RFBIWTDZSA-N |
| XLogP | 3.56 |
| TPSA | 137.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|