C14H11N2O4S- — CID 4571760
2-oxo-2-phenyl-1-(phenylhydrazinylidene)ethanesulfonate (PubChem CID 4571760) has the molecular formula C14H11N2O4S- and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-oxo-2-phenyl-1-(phenylhydrazinylidene)ethanesulfonate.
| Compound Name | 2-oxo-2-phenyl-1-(phenylhydrazinylidene)ethanesulfonate |
|---|---|
| PubChem CID | 4571760 |
| Molecular Formula | C14H11N2O4S- |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-oxo-2-phenyl-1-(phenylhydrazinylidene)ethanesulfonate |
| SMILES | O=C(C(=NNc1ccccc1)S(=O)(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C14H12N2O4S/c17-13(11-7-3-1-4-8-11)14(21(18,19)20)16-15-12-9-5-2-6-10-12/h1-10,15H,(H,18,19,20)/p-1 |
| InChIKey | MEQKFHIMVVDRHZ-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|