C38H54N4O6 — CID 175667606
3,3-bis[4-[3-(2,2-dimethylhydrazinyl)-2-hydroxypropoxy]-5-methyl-2-propan-2-ylphenyl]-2-benzofuran-1-one (PubChem CID 175667606) has the molecular formula C38H54N4O6 and a molecular weight of 662.87 g/mol. Its IUPAC name is 3,3-bis[4-[3-(2,2-dimethylhydrazinyl)-2-hydroxypropoxy]-5-methyl-2-propan-2-ylphenyl]-2-benzofuran-1-one.
| Compound Name | 3,3-bis[4-[3-(2,2-dimethylhydrazinyl)-2-hydroxypropoxy]-5-methyl-2-propan-2-ylphenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 175667606 |
| Molecular Formula | C38H54N4O6 |
| Molecular Weight | 662.87 g/mol |
| Exact Mass | 662.40 |
| IUPAC Name | 3,3-bis[4-[3-(2,2-dimethylhydrazinyl)-2-hydroxypropoxy]-5-methyl-2-propan-2-ylphenyl]-2-benzofuran-1-one |
| SMILES | Cc1cc(C2(c3cc(C)c(OCC(O)CNN(C)C)cc3C(C)C)OC(=O)c3ccccc32)c(C(C)C)cc1OCC(O)CNN(C)C |
| InChI | InChI=1S/C38H54N4O6/c1-23(2)30-17-35(46-21-27(43)19-39-41(7)8)25(5)15-33(30)38(32-14-12-11-13-29(32)37(45)48-38)34-16-26(6)36(18-31(34)24(3)4)47-22-28(44)20-40-42(9)10/h11-18,23-24,27-28,39-40,43-44H,19-22H2,1-10H3 |
| InChIKey | PHACISMFXACPLM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|