About 2-cyanoethyl (E)-3-acetyloxybut-2-enoate
2-cyanoethyl (E)-3-acetyloxybut-2-enoate (PubChem CID 175675511) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-cyanoethyl (E)-3-acetyloxybut-2-enoate.
Molecular Properties
| Compound Name | 2-cyanoethyl (E)-3-acetyloxybut-2-enoate |
| PubChem CID | 175675511 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-cyanoethyl (E)-3-acetyloxybut-2-enoate |
| SMILES | CC(=O)O/C(C)=C/C(=O)OCCC#N |
| InChI | InChI=1S/C9H11NO4/c1-7(14-8(2)11)6-9(12)13-5-3-4-10/h6H,3,5H2,1-2H3/b7-6+ |
| InChIKey | BSMAERZMPFWJKZ-VOTSOKGWSA-N |
| XLogP | 0.91 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl (E)-3-acetyloxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl (E)-3-acetyloxybut-2-enoate?
The IUPAC name of 2-cyanoethyl (E)-3-acetyloxybut-2-enoate (CID 175675511) is 2-cyanoethyl (E)-3-acetyloxybut-2-enoate.
What is the SMILES notation for 2-cyanoethyl (E)-3-acetyloxybut-2-enoate?
The canonical SMILES for 2-cyanoethyl (E)-3-acetyloxybut-2-enoate is CC(=O)O/C(C)=C/C(=O)OCCC#N.
What is the InChIKey of 2-cyanoethyl (E)-3-acetyloxybut-2-enoate?
The InChIKey is BSMAERZMPFWJKZ-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H11NO4/c1-7(14-8(2)11)6-9(12)13-5-3-4-10/h6H,3,5H2,1-2H3/b7-6+.
What are the key properties of 2-cyanoethyl (E)-3-acetyloxybut-2-enoate?
2-cyanoethyl (E)-3-acetyloxybut-2-enoate has a molecular weight of 197.19 g/mol, XLogP of 0.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl (E)-3-acetyloxybut-2-enoate is sourced from PubChem (CID 175675511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).