About 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate
2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate (PubChem CID 70073168) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate |
| PubChem CID | 70073168 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate |
| SMILES | N#CCCOC(=O)/C=C(/N)c1ccccc1 |
| InChI | InChI=1S/C12H12N2O2/c13-7-4-8-16-12(15)9-11(14)10-5-2-1-3-6-10/h1-3,5-6,9H,4,8,14H2/b11-9+ |
| InChIKey | BGKPOGLDVXXSQI-PKNBQFBNSA-N |
| XLogP | 1.44 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate?
The IUPAC name of 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate (CID 70073168) is 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate.
What is the SMILES notation for 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate?
The canonical SMILES for 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate is N#CCCOC(=O)/C=C(/N)c1ccccc1.
What is the InChIKey of 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate?
The InChIKey is BGKPOGLDVXXSQI-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H12N2O2/c13-7-4-8-16-12(15)9-11(14)10-5-2-1-3-6-10/h1-3,5-6,9H,4,8,14H2/b11-9+.
What are the key properties of 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate?
2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate has a molecular weight of 216.24 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl (E)-3-amino-3-phenylprop-2-enoate is sourced from PubChem (CID 70073168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).