C20H38O3 — CID 175678465
(E,4S,6S,8R,10S)-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undec-2-en-1-ol (PubChem CID 175678465) has the molecular formula C20H38O3 and a molecular weight of 326.52 g/mol. Its IUPAC name is (E,4S,6S,8R,10S)-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undec-2-en-1-ol.
| Compound Name | (E,4S,6S,8R,10S)-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undec-2-en-1-ol |
|---|---|
| PubChem CID | 175678465 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | (E,4S,6S,8R,10S)-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undec-2-en-1-ol |
| SMILES | C[C@@H](C[C@H](C)COC1CCCCO1)C[C@H](C)C[C@H](C)/C=C/CO |
| InChI | InChI=1S/C20H38O3/c1-16(8-7-10-21)12-17(2)13-18(3)14-19(4)15-23-20-9-5-6-11-22-20/h7-8,16-21H,5-6,9-15H2,1-4H3/b8-7+/t16-,17-,18-,19+,20?/m1/s1 |
| InChIKey | ODKCAJSDCARNGO-HQEUBKMPSA-N |
| XLogP | 4.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|