C23H19F2N5O4S — CID 175679654
4-[[4-[[5-(2,4-difluoro-3-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methyl]-5,7-dioxo-4,6-diazaspiro[2.4]heptan-6-yl]methyl]-N-methylbenzamide (PubChem CID 175679654) has the molecular formula C23H19F2N5O4S and a molecular weight of 499.50 g/mol. Its IUPAC name is 4-[[4-[[5-(2,4-difluoro-3-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methyl]-5,7-dioxo-4,6-diazaspiro[2.4]heptan-6-yl]methyl]-N-methylbenzamide.
| Compound Name | 4-[[4-[[5-(2,4-difluoro-3-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methyl]-5,7-dioxo-4,6-diazaspiro[2.4]heptan-6-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 175679654 |
| Molecular Formula | C23H19F2N5O4S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 4-[[4-[[5-(2,4-difluoro-3-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methyl]-5,7-dioxo-4,6-diazaspiro[2.4]heptan-6-yl]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN2C(=O)N(Cc3nnc(-c4ccc(F)c(O)c4F)s3)C3(CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H19F2N5O4S/c1-26-19(32)13-4-2-12(3-5-13)10-29-21(33)23(8-9-23)30(22(29)34)11-16-27-28-20(35-16)14-6-7-15(24)18(31)17(14)25/h2-7,31H,8-11H2,1H3,(H,26,32) |
| InChIKey | GLDLDXPUNDHVTK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|