C16H13F3N4O2S — CID 176572813
4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]-6-(2,2,2-trifluoroethyl)-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 176572813) has the molecular formula C16H13F3N4O2S and a molecular weight of 382.37 g/mol. Its IUPAC name is 4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]-6-(2,2,2-trifluoroethyl)-4,6-diazaspiro[2.4]heptane-5,7-dione.
| Compound Name | 4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]-6-(2,2,2-trifluoroethyl)-4,6-diazaspiro[2.4]heptane-5,7-dione |
|---|---|
| PubChem CID | 176572813 |
| Molecular Formula | C16H13F3N4O2S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]-6-(2,2,2-trifluoroethyl)-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | O=C1N(CC(F)(F)F)C(=O)C2(CC2)N1Cc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H13F3N4O2S/c17-16(18,19)9-22-13(24)15(6-7-15)23(14(22)25)8-11-20-21-12(26-11)10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | JHIJYBXFZPBKCC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|