C18H16N4O2S — CID 166103775
1-(1-bicyclo[1.1.1]pentanyl)-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]pyrazine-2,3-dione (PubChem CID 166103775) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-(1-bicyclo[1.1.1]pentanyl)-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]pyrazine-2,3-dione.
| Compound Name | 1-(1-bicyclo[1.1.1]pentanyl)-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 166103775 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-(1-bicyclo[1.1.1]pentanyl)-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]pyrazine-2,3-dione |
| SMILES | O=c1c(=O)n(C23CC(C2)C3)ccn1Cc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H16N4O2S/c23-16-17(24)22(18-8-12(9-18)10-18)7-6-21(16)11-14-19-20-15(25-14)13-4-2-1-3-5-13/h1-7,12H,8-11H2 |
| InChIKey | HEZXJSQEZIPKKT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|