C21H13F6N5O3S — CID 175679649
6-[1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]-4-[[5-(5-fluoro-6-oxo-1H-pyridin-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 175679649) has the molecular formula C21H13F6N5O3S and a molecular weight of 529.42 g/mol. Its IUPAC name is 6-[1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]-4-[[5-(5-fluoro-6-oxo-1H-pyridin-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-4,6-diazaspiro[2.4]heptane-5,7-dione.
| Compound Name | 6-[1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]-4-[[5-(5-fluoro-6-oxo-1H-pyridin-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
|---|---|
| PubChem CID | 175679649 |
| Molecular Formula | C21H13F6N5O3S |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | 6-[1-(2,4-difluorophenyl)-2,2,2-trifluoroethyl]-4-[[5-(5-fluoro-6-oxo-1H-pyridin-2-yl)-1,3,4-thiadiazol-2-yl]methyl]-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | O=C1N(C(c2ccc(F)cc2F)C(F)(F)F)C(=O)C2(CC2)N1Cc1nnc(-c2ccc(F)c(=O)[nH]2)s1 |
| InChI | InChI=1S/C21H13F6N5O3S/c22-9-1-2-10(12(24)7-9)15(21(25,26)27)32-18(34)20(5-6-20)31(19(32)35)8-14-29-30-17(36-14)13-4-3-11(23)16(33)28-13/h1-4,7,15H,5-6,8H2,(H,28,33) |
| InChIKey | UGMJBXNPQQVIQB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|