C19H20N8O2 — CID 175680213
N-[(3R,5S)-1-cyano-5-(1,5-dihydro-1,2,4-triazol-4-ylmethyl)pyrrolidin-3-yl]-5-(3-cyanophenyl)-2,3-dihydro-1,3-oxazole-2-carboxamide (PubChem CID 175680213) has the molecular formula C19H20N8O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[(3R,5S)-1-cyano-5-(1,5-dihydro-1,2,4-triazol-4-ylmethyl)pyrrolidin-3-yl]-5-(3-cyanophenyl)-2,3-dihydro-1,3-oxazole-2-carboxamide.
| Compound Name | N-[(3R,5S)-1-cyano-5-(1,5-dihydro-1,2,4-triazol-4-ylmethyl)pyrrolidin-3-yl]-5-(3-cyanophenyl)-2,3-dihydro-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 175680213 |
| Molecular Formula | C19H20N8O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[(3R,5S)-1-cyano-5-(1,5-dihydro-1,2,4-triazol-4-ylmethyl)pyrrolidin-3-yl]-5-(3-cyanophenyl)-2,3-dihydro-1,3-oxazole-2-carboxamide |
| SMILES | N#Cc1cccc(C2=CNC(C(=O)N[C@@H]3C[C@@H](CN4C=NNC4)N(C#N)C3)O2)c1 |
| InChI | InChI=1S/C19H20N8O2/c20-6-13-2-1-3-14(4-13)17-7-22-19(29-17)18(28)25-15-5-16(27(8-15)10-21)9-26-11-23-24-12-26/h1-4,7,11,15-16,19,22,24H,5,8-9,12H2,(H,25,28)/t15-,16+,19?/m1/s1 |
| InChIKey | ZQDIYIGQOPITEC-IEAUQHRDSA-N |
| XLogP | -0.35 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|