C19H12N4O5S — CID 175684547
5-[(2-nitrophenyl)methylidene]-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 175684547) has the molecular formula C19H12N4O5S and a molecular weight of 408.40 g/mol. Its IUPAC name is 5-[(2-nitrophenyl)methylidene]-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(2-nitrophenyl)methylidene]-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 175684547 |
| Molecular Formula | C19H12N4O5S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 5-[(2-nitrophenyl)methylidene]-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccccc2[N+](=O)[O-])C(=O)N1Cc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H12N4O5S/c24-18-15(10-13-8-4-5-9-14(13)23(26)27)29-19(25)22(18)11-16-20-17(21-28-16)12-6-2-1-3-7-12/h1-10H,11H2 |
| InChIKey | LSQDZQIHNFOZJT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|