C20H12F3N3O3S — CID 175684554
3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 175684554) has the molecular formula C20H12F3N3O3S and a molecular weight of 431.40 g/mol. Its IUPAC name is 3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 175684554 |
| Molecular Formula | C20H12F3N3O3S |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc(C(F)(F)F)cc2)C(=O)N1Cc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C20H12F3N3O3S/c21-20(22,23)14-8-6-12(7-9-14)10-15-18(27)26(19(28)30-15)11-16-24-17(25-29-16)13-4-2-1-3-5-13/h1-10H,11H2 |
| InChIKey | ZEJLSGPQXODLOK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|