C11H22O4S — CID 175685963
(3R,4S)-6-hexylsulfanyloxane-2,3,4-triol (PubChem CID 175685963) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is (3R,4S)-6-hexylsulfanyloxane-2,3,4-triol.
| Compound Name | (3R,4S)-6-hexylsulfanyloxane-2,3,4-triol |
|---|---|
| PubChem CID | 175685963 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3R,4S)-6-hexylsulfanyloxane-2,3,4-triol |
| SMILES | CCCCCCSC1C[C@H](O)[C@@H](O)C(O)O1 |
| InChI | InChI=1S/C11H22O4S/c1-2-3-4-5-6-16-9-7-8(12)10(13)11(14)15-9/h8-14H,2-7H2,1H3/t8-,9?,10+,11?/m0/s1 |
| InChIKey | ZFZHNWQAXRDQJE-QPBDYMMBSA-N |
| XLogP | 1.09 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|