C15H25NO4 — CID 175691146
tert-butyl 2,7-dioxa-11-azadispiro[2.0.54.43]tridecane-11-carboxylate (PubChem CID 175691146) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl 2,7-dioxa-11-azadispiro[2.0.54.43]tridecane-11-carboxylate.
| Compound Name | tert-butyl 2,7-dioxa-11-azadispiro[2.0.54.43]tridecane-11-carboxylate |
|---|---|
| PubChem CID | 175691146 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | tert-butyl 2,7-dioxa-11-azadispiro[2.0.54.43]tridecane-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CO2)C2(CCOCC2)C1 |
| InChI | InChI=1S/C15H25NO4/c1-13(2,3)20-12(17)16-7-4-15(11-19-15)14(10-16)5-8-18-9-6-14/h4-11H2,1-3H3 |
| InChIKey | RRDGGQLMYXTYPX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|