About 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium)
1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium) (PubChem CID 175694228) has the molecular formula C8H14O4P2+2
and a molecular weight of 238.16 g/mol. Its IUPAC name is 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium).
Molecular Properties
| Compound Name | 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium) |
| PubChem CID | 175694228 |
| Molecular Formula | C8H14O4P2+2 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium) |
| SMILES | C[P+](=O)O.C[P+](=O)O.[2H]c1ccc([2H])cc1 |
| InChI | InChI=1S/C6H6.2CH3O2P/c1-2-4-6-5-3-1;2*1-4(2)3/h1-6H;2*1H3/p+2/i1D,6D;; |
| InChIKey | CUPBRXBTRFKOAF-IQMZZIDLSA-P |
| XLogP | 2.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium)?
The IUPAC name of 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium) (CID 175694228) is 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium).
What is the SMILES notation for 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium)?
The canonical SMILES for 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium) is C[P+](=O)O.C[P+](=O)O.[2H]c1ccc([2H])cc1.
What is the InChIKey of 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium)?
The InChIKey is CUPBRXBTRFKOAF-IQMZZIDLSA-P. The full InChI is InChI=1S/C6H6.2CH3O2P/c1-2-4-6-5-3-1;2*1-4(2)3/h1-6H;2*1H3/p+2/i1D,6D;;.
What are the key properties of 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium)?
1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium) has a molecular weight of 238.16 g/mol, XLogP of 2.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dideuteriobenzene;bis(hydroxy-methyl-oxophosphanium) is sourced from PubChem (CID 175694228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).