C14H17N3OS2 — CID 175697387
1,3,5-trimethyl-2,6-bis(1,3-thiazol-4-yl)piperidin-4-one (PubChem CID 175697387) has the molecular formula C14H17N3OS2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1,3,5-trimethyl-2,6-bis(1,3-thiazol-4-yl)piperidin-4-one.
| Compound Name | 1,3,5-trimethyl-2,6-bis(1,3-thiazol-4-yl)piperidin-4-one |
|---|---|
| PubChem CID | 175697387 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 1,3,5-trimethyl-2,6-bis(1,3-thiazol-4-yl)piperidin-4-one |
| SMILES | CC1C(=O)C(C)C(c2cscn2)N(C)C1c1cscn1 |
| InChI | InChI=1S/C14H17N3OS2/c1-8-12(10-4-19-6-15-10)17(3)13(9(2)14(8)18)11-5-20-7-16-11/h4-9,12-13H,1-3H3 |
| InChIKey | BNUINENGJHITHF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |