C19H16N6O2 — CID 175699766
12-deuterio-11-pyridin-4-yl-5-(pyridin-3-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9-diene-2,6-dione (PubChem CID 175699766) has the molecular formula C19H16N6O2 and a molecular weight of 361.38 g/mol. Its IUPAC name is 12-deuterio-11-pyridin-4-yl-5-(pyridin-3-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9-diene-2,6-dione.
| Compound Name | 12-deuterio-11-pyridin-4-yl-5-(pyridin-3-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9-diene-2,6-dione |
|---|---|
| PubChem CID | 175699766 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 12-deuterio-11-pyridin-4-yl-5-(pyridin-3-ylmethyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9-diene-2,6-dione |
| SMILES | [2H]N1C(c2ccncc2)C=C2NC3=C(CN(Cc4cccnc4)C3=O)C(=O)N21 |
| InChI | InChI=1S/C19H16N6O2/c26-18-14-11-24(10-12-2-1-5-21-9-12)19(27)17(14)22-16-8-15(23-25(16)18)13-3-6-20-7-4-13/h1-9,15,22-23H,10-11H2/i/hD |
| InChIKey | RVTGGQXSBXNMMV-DYCDLGHISA-N |
| XLogP | 0.61 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |