C12H15NO3S — CID 175701962
(4-methylphenyl)sulfonyl-[(2S)-pyrrolidin-2-yl]methanone (PubChem CID 175701962) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl-[(2S)-pyrrolidin-2-yl]methanone.
| Compound Name | (4-methylphenyl)sulfonyl-[(2S)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 175701962 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (4-methylphenyl)sulfonyl-[(2S)-pyrrolidin-2-yl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)C(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C12H15NO3S/c1-9-4-6-10(7-5-9)17(15,16)12(14)11-3-2-8-13-11/h4-7,11,13H,2-3,8H2,1H3/t11-/m0/s1 |
| InChIKey | PHQZWORXSFESCG-NSHDSACASA-N |
| XLogP | 1.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|