C19H19FN4O4S2 — CID 175702234
3-[(5-fluoro-2-piperidin-1-yl-3-pyridinyl)sulfamoyl]-N-hydroxy-1-benzothiophene-2-carboxamide (PubChem CID 175702234) has the molecular formula C19H19FN4O4S2 and a molecular weight of 450.52 g/mol. Its IUPAC name is 3-[(5-fluoro-2-piperidin-1-yl-3-pyridinyl)sulfamoyl]-N-hydroxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[(5-fluoro-2-piperidin-1-yl-3-pyridinyl)sulfamoyl]-N-hydroxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 175702234 |
| Molecular Formula | C19H19FN4O4S2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 3-[(5-fluoro-2-piperidin-1-yl-3-pyridinyl)sulfamoyl]-N-hydroxy-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NO)c1sc2ccccc2c1S(=O)(=O)Nc1cc(F)cnc1N1CCCCC1 |
| InChI | InChI=1S/C19H19FN4O4S2/c20-12-10-14(18(21-11-12)24-8-4-1-5-9-24)23-30(27,28)17-13-6-2-3-7-15(13)29-16(17)19(25)22-26/h2-3,6-7,10-11,23,26H,1,4-5,8-9H2,(H,22,25) |
| InChIKey | IZOJDOVHIFDCSZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|