C19H17F3N4O5S — CID 155233706
6-[[2-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide (PubChem CID 155233706) has the molecular formula C19H17F3N4O5S and a molecular weight of 470.43 g/mol. Its IUPAC name is 6-[[2-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide.
| Compound Name | 6-[[2-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 155233706 |
| Molecular Formula | C19H17F3N4O5S |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 6-[[2-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide |
| SMILES | O=C(NO)c1cc2ccc(S(=O)(=O)Nc3cc(F)cnc3N3CCC(F)(F)CC3)cc2o1 |
| InChI | InChI=1S/C19H17F3N4O5S/c20-12-8-14(17(23-10-12)26-5-3-19(21,22)4-6-26)25-32(29,30)13-2-1-11-7-16(18(27)24-28)31-15(11)9-13/h1-2,7-10,25,28H,3-6H2,(H,24,27) |
| InChIKey | WCRYGJKTTRHYDG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|