C19H18F2N4O5S — CID 155233704
6-[[2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide (PubChem CID 155233704) has the molecular formula C19H18F2N4O5S and a molecular weight of 452.44 g/mol. Its IUPAC name is 6-[[2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide.
| Compound Name | 6-[[2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 155233704 |
| Molecular Formula | C19H18F2N4O5S |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 6-[[2-(4,4-difluoropiperidin-1-yl)-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide |
| SMILES | O=C(NO)c1cc2ccc(S(=O)(=O)Nc3cccnc3N3CCC(F)(F)CC3)cc2o1 |
| InChI | InChI=1S/C19H18F2N4O5S/c20-19(21)5-8-25(9-6-19)17-14(2-1-7-22-17)24-31(28,29)13-4-3-12-10-16(18(26)23-27)30-15(12)11-13/h1-4,7,10-11,24,27H,5-6,8-9H2,(H,23,26) |
| InChIKey | BJBWJPWTPKWOPB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|