C22H23ClN4O6S — CID 155242672
6-[[5-chloro-2-(8-oxa-2-azaspiro[4.5]decan-2-yl)-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide (PubChem CID 155242672) has the molecular formula C22H23ClN4O6S and a molecular weight of 506.97 g/mol. Its IUPAC name is 6-[[5-chloro-2-(8-oxa-2-azaspiro[4.5]decan-2-yl)-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide.
| Compound Name | 6-[[5-chloro-2-(8-oxa-2-azaspiro[4.5]decan-2-yl)-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 155242672 |
| Molecular Formula | C22H23ClN4O6S |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 6-[[5-chloro-2-(8-oxa-2-azaspiro[4.5]decan-2-yl)-3-pyridinyl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide |
| SMILES | O=C(NO)c1cc2ccc(S(=O)(=O)Nc3cc(Cl)cnc3N3CCC4(CCOCC4)C3)cc2o1 |
| InChI | InChI=1S/C22H23ClN4O6S/c23-15-10-17(20(24-12-15)27-6-3-22(13-27)4-7-32-8-5-22)26-34(30,31)16-2-1-14-9-19(21(28)25-29)33-18(14)11-16/h1-2,9-12,26,29H,3-8,13H2,(H,25,28) |
| InChIKey | UJHCETCJMJRHOU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|