C18H21N5O7S — CID 155242387
6-[[4-(4-ethoxypiperidin-1-yl)-1,2,5-oxadiazol-3-yl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide (PubChem CID 155242387) has the molecular formula C18H21N5O7S and a molecular weight of 451.46 g/mol. Its IUPAC name is 6-[[4-(4-ethoxypiperidin-1-yl)-1,2,5-oxadiazol-3-yl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide.
| Compound Name | 6-[[4-(4-ethoxypiperidin-1-yl)-1,2,5-oxadiazol-3-yl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 155242387 |
| Molecular Formula | C18H21N5O7S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 6-[[4-(4-ethoxypiperidin-1-yl)-1,2,5-oxadiazol-3-yl]sulfamoyl]-N-hydroxy-1-benzofuran-2-carboxamide |
| SMILES | CCOC1CCN(c2nonc2NS(=O)(=O)c2ccc3cc(C(=O)NO)oc3c2)CC1 |
| InChI | InChI=1S/C18H21N5O7S/c1-2-28-12-5-7-23(8-6-12)17-16(20-30-21-17)22-31(26,27)13-4-3-11-9-15(18(24)19-25)29-14(11)10-13/h3-4,9-10,12,25H,2,5-8H2,1H3,(H,19,24)(H,20,22) |
| InChIKey | HZROFWPIMASVLW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 160.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|