C19H20N4O6S — CID 155242385
N-hydroxy-6-[(2-piperidin-4-yloxy-3-pyridinyl)sulfamoyl]-1-benzofuran-2-carboxamide (PubChem CID 155242385) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is N-hydroxy-6-[(2-piperidin-4-yloxy-3-pyridinyl)sulfamoyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-hydroxy-6-[(2-piperidin-4-yloxy-3-pyridinyl)sulfamoyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 155242385 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-hydroxy-6-[(2-piperidin-4-yloxy-3-pyridinyl)sulfamoyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NO)c1cc2ccc(S(=O)(=O)Nc3cccnc3OC3CCNCC3)cc2o1 |
| InChI | InChI=1S/C19H20N4O6S/c24-18(22-25)17-10-12-3-4-14(11-16(12)29-17)30(26,27)23-15-2-1-7-21-19(15)28-13-5-8-20-9-6-13/h1-4,7,10-11,13,20,23,25H,5-6,8-9H2,(H,22,24) |
| InChIKey | ORGPAKHPHWFJAK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|