C20H26FN5O4S — CID 50828223
5-[(4-fluorophenyl)sulfonylamino]-N-(3-methoxypropyl)-6-piperazin-1-ylpyridine-3-carboxamide (PubChem CID 50828223) has the molecular formula C20H26FN5O4S and a molecular weight of 451.52 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)sulfonylamino]-N-(3-methoxypropyl)-6-piperazin-1-ylpyridine-3-carboxamide.
| Compound Name | 5-[(4-fluorophenyl)sulfonylamino]-N-(3-methoxypropyl)-6-piperazin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 50828223 |
| Molecular Formula | C20H26FN5O4S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 5-[(4-fluorophenyl)sulfonylamino]-N-(3-methoxypropyl)-6-piperazin-1-ylpyridine-3-carboxamide |
| SMILES | COCCCNC(=O)c1cnc(N2CCNCC2)c(NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H26FN5O4S/c1-30-12-2-7-23-20(27)15-13-18(19(24-14-15)26-10-8-22-9-11-26)25-31(28,29)17-5-3-16(21)4-6-17/h3-6,13-14,22,25H,2,7-12H2,1H3,(H,23,27) |
| InChIKey | PHRXBSBHGPOZCG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|