C30H40ClO2PPd+2 — CID 175702479
[2-but-2-enyl-3-chloro-6-(2,6-dimethoxyphenyl)phenyl]-dicyclohexylphosphane;palladium(2+) (PubChem CID 175702479) has the molecular formula C30H40ClO2PPd+2 and a molecular weight of 605.50 g/mol. Its IUPAC name is [2-but-2-enyl-3-chloro-6-(2,6-dimethoxyphenyl)phenyl]-dicyclohexylphosphane;palladium(2+).
| Compound Name | [2-but-2-enyl-3-chloro-6-(2,6-dimethoxyphenyl)phenyl]-dicyclohexylphosphane;palladium(2+) |
|---|---|
| PubChem CID | 175702479 |
| Molecular Formula | C30H40ClO2PPd+2 |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | [2-but-2-enyl-3-chloro-6-(2,6-dimethoxyphenyl)phenyl]-dicyclohexylphosphane;palladium(2+) |
| SMILES | CC=CCc1c(Cl)ccc(-c2c(OC)cccc2OC)c1P(C1CCCCC1)C1CCCCC1.[Pd+2] |
| InChI | InChI=1S/C30H40ClO2P.Pd/c1-4-5-17-24-26(31)21-20-25(29-27(32-2)18-12-19-28(29)33-3)30(24)34(22-13-8-6-9-14-22)23-15-10-7-11-16-23;/h4-5,12,18-23H,6-11,13-17H2,1-3H3;/q;+2 |
| InChIKey | WJHHELBBDYMJFQ-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|