C21H42O6 — CID 175704891
2-tert-butyl-3,3-dimethylbutaneperoxoic acid;tert-butyl 4,4-dimethylpentaneperoxoate (PubChem CID 175704891) has the molecular formula C21H42O6 and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-tert-butyl-3,3-dimethylbutaneperoxoic acid;tert-butyl 4,4-dimethylpentaneperoxoate.
| Compound Name | 2-tert-butyl-3,3-dimethylbutaneperoxoic acid;tert-butyl 4,4-dimethylpentaneperoxoate |
|---|---|
| PubChem CID | 175704891 |
| Molecular Formula | C21H42O6 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 2-tert-butyl-3,3-dimethylbutaneperoxoic acid;tert-butyl 4,4-dimethylpentaneperoxoate |
| SMILES | CC(C)(C)C(C(=O)OO)C(C)(C)C.CC(C)(C)CCC(=O)OOC(C)(C)C |
| InChI | InChI=1S/C11H22O3.C10H20O3/c1-10(2,3)8-7-9(12)13-14-11(4,5)6;1-9(2,3)7(8(11)13-12)10(4,5)6/h7-8H2,1-6H3;7,12H,1-6H3 |
| InChIKey | PYMWMUHFFBBDEZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|