C27H54O6 — CID 160505791
tert-butyl 2,2-dimethylpropaneperoxoate;7,7-dimethyl-2-(2,4,4-trimethylpentan-2-yl)octaneperoxoic acid (PubChem CID 160505791) has the molecular formula C27H54O6 and a molecular weight of 474.72 g/mol. Its IUPAC name is tert-butyl 2,2-dimethylpropaneperoxoate;7,7-dimethyl-2-(2,4,4-trimethylpentan-2-yl)octaneperoxoic acid.
| Compound Name | tert-butyl 2,2-dimethylpropaneperoxoate;7,7-dimethyl-2-(2,4,4-trimethylpentan-2-yl)octaneperoxoic acid |
|---|---|
| PubChem CID | 160505791 |
| Molecular Formula | C27H54O6 |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | tert-butyl 2,2-dimethylpropaneperoxoate;7,7-dimethyl-2-(2,4,4-trimethylpentan-2-yl)octaneperoxoic acid |
| SMILES | CC(C)(C)CCCCC(C(=O)OO)C(C)(C)CC(C)(C)C.CC(C)(C)OOC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H36O3.C9H18O3/c1-16(2,3)12-10-9-11-14(15(19)21-20)18(7,8)13-17(4,5)6;1-8(2,3)7(10)11-12-9(4,5)6/h14,20H,9-13H2,1-8H3;1-6H3 |
| InChIKey | QSJPTWOGLOAAOE-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|