About 4-deuteriooctanoic acid
4-deuteriooctanoic acid (PubChem CID 175705635) has the molecular formula C8H16O2
and a molecular weight of 145.22 g/mol. Its IUPAC name is 4-deuteriooctanoic acid.
Molecular Properties
| Compound Name | 4-deuteriooctanoic acid |
| PubChem CID | 175705635 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 4-deuteriooctanoic acid |
| SMILES | [2H]C(CCCC)CCC(=O)O |
| InChI | InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/i5D |
| InChIKey | WWZKQHOCKIZLMA-UICOGKGYSA-N |
| XLogP | 2.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-deuteriooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-deuteriooctanoic acid?
The IUPAC name of 4-deuteriooctanoic acid (CID 175705635) is 4-deuteriooctanoic acid.
What is the SMILES notation for 4-deuteriooctanoic acid?
The canonical SMILES for 4-deuteriooctanoic acid is [2H]C(CCCC)CCC(=O)O.
What is the InChIKey of 4-deuteriooctanoic acid?
The InChIKey is WWZKQHOCKIZLMA-UICOGKGYSA-N. The full InChI is InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/i5D.
What are the key properties of 4-deuteriooctanoic acid?
4-deuteriooctanoic acid has a molecular weight of 145.22 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-deuteriooctanoic acid is sourced from PubChem (CID 175705635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).