C14H14N2O — CID 175710279
(2R)-2-ethyl-2,3-dihydropyrido[3,2-h][1,4]benzoxazepine (PubChem CID 175710279) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is (2R)-2-ethyl-2,3-dihydropyrido[3,2-h][1,4]benzoxazepine.
| Compound Name | (2R)-2-ethyl-2,3-dihydropyrido[3,2-h][1,4]benzoxazepine |
|---|---|
| PubChem CID | 175710279 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (2R)-2-ethyl-2,3-dihydropyrido[3,2-h][1,4]benzoxazepine |
| SMILES | CC[C@@H]1CN=Cc2cc3cccnc3cc2O1 |
| InChI | InChI=1S/C14H14N2O/c1-2-12-9-15-8-11-6-10-4-3-5-16-13(10)7-14(11)17-12/h3-8,12H,2,9H2,1H3/t12-/m1/s1 |
| InChIKey | OLPULSWMSUUXET-GFCCVEGCSA-N |
| XLogP | 2.82 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |