C17H14F3N5O2 — CID 175711504
methyl 6-carbamimidoyl-2-[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]pyridine-3-carboxylate (PubChem CID 175711504) has the molecular formula C17H14F3N5O2 and a molecular weight of 377.33 g/mol. Its IUPAC name is methyl 6-carbamimidoyl-2-[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-carbamimidoyl-2-[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 175711504 |
| Molecular Formula | C17H14F3N5O2 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | methyl 6-carbamimidoyl-2-[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]pyridine-3-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)OC)c(-c2nc3cc(C(F)(F)F)ccc3n2C)n1 |
| InChI | InChI=1S/C17H14F3N5O2/c1-25-12-6-3-8(17(18,19)20)7-11(12)24-15(25)13-9(16(26)27-2)4-5-10(23-13)14(21)22/h3-7H,1-2H3,(H3,21,22) |
| InChIKey | CHIVWOIYHQZFPX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|