C21H24BrN3O3S — CID 175719249
ethyl (2S,3S)-2-amino-3-[(6-benzyl-2,5-dihydropyridin-4-yl)methoxy]-3-(4-bromo-1,3-thiazol-2-yl)propanoate (PubChem CID 175719249) has the molecular formula C21H24BrN3O3S and a molecular weight of 478.41 g/mol. Its IUPAC name is ethyl (2S,3S)-2-amino-3-[(6-benzyl-2,5-dihydropyridin-4-yl)methoxy]-3-(4-bromo-1,3-thiazol-2-yl)propanoate.
| Compound Name | ethyl (2S,3S)-2-amino-3-[(6-benzyl-2,5-dihydropyridin-4-yl)methoxy]-3-(4-bromo-1,3-thiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 175719249 |
| Molecular Formula | C21H24BrN3O3S |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | ethyl (2S,3S)-2-amino-3-[(6-benzyl-2,5-dihydropyridin-4-yl)methoxy]-3-(4-bromo-1,3-thiazol-2-yl)propanoate |
| SMILES | CCOC(=O)[C@@H](N)[C@H](OCC1=CCN=C(Cc2ccccc2)C1)c1nc(Br)cs1 |
| InChI | InChI=1S/C21H24BrN3O3S/c1-2-27-21(26)18(23)19(20-25-17(22)13-29-20)28-12-15-8-9-24-16(11-15)10-14-6-4-3-5-7-14/h3-8,13,18-19H,2,9-12,23H2,1H3/t18-,19-/m0/s1 |
| InChIKey | YJGPINZJRHETCP-OALUTQOASA-N |
| XLogP | 3.87 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|