C15H20ClNO2 — CID 175722951
3-(3-chloropropyl)-7,8-dimethoxy-1,2-dihydro-3-benzazepine (PubChem CID 175722951) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 3-(3-chloropropyl)-7,8-dimethoxy-1,2-dihydro-3-benzazepine.
| Compound Name | 3-(3-chloropropyl)-7,8-dimethoxy-1,2-dihydro-3-benzazepine |
|---|---|
| PubChem CID | 175722951 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(3-chloropropyl)-7,8-dimethoxy-1,2-dihydro-3-benzazepine |
| SMILES | COc1cc2c(cc1OC)CCN(CCCCl)C=C2 |
| InChI | InChI=1S/C15H20ClNO2/c1-18-14-10-12-4-8-17(7-3-6-16)9-5-13(12)11-15(14)19-2/h4,8,10-11H,3,5-7,9H2,1-2H3 |
| InChIKey | RXQJGJMNGFUACT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|