C20H24MgN2O10S2 — CID 175732361
magnesium bis((2S)-3-hydroxy-2-(4-methylsulfonylanilino)propanoate) (PubChem CID 175732361) has the molecular formula C20H24MgN2O10S2 and a molecular weight of 540.86 g/mol. Its IUPAC name is magnesium bis((2S)-3-hydroxy-2-(4-methylsulfonylanilino)propanoate).
| Compound Name | magnesium bis((2S)-3-hydroxy-2-(4-methylsulfonylanilino)propanoate) |
|---|---|
| PubChem CID | 175732361 |
| Molecular Formula | C20H24MgN2O10S2 |
| Molecular Weight | 540.86 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | magnesium bis((2S)-3-hydroxy-2-(4-methylsulfonylanilino)propanoate) |
| SMILES | CS(=O)(=O)c1ccc(N[C@@H](CO)C(=O)[O-])cc1.CS(=O)(=O)c1ccc(N[C@@H](CO)C(=O)[O-])cc1.[Mg+2] |
| InChI | InChI=1S/2C10H13NO5S.Mg/c2*1-17(15,16)8-4-2-7(3-5-8)11-9(6-12)10(13)14;/h2*2-5,9,11-12H,6H2,1H3,(H,13,14);/q;;+2/p-2/t2*9-;/m00./s1 |
| InChIKey | FBZYYVJNYDCUFT-NAWJVIAPSA-L |
| XLogP | -3.16 |
| TPSA | 213.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.86 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |