C14H18N2 — CID 175734127
2-N-methyl-2-N-(1-methylcyclohexa-2,4-dien-1-yl)benzene-1,2-diamine (PubChem CID 175734127) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-N-methyl-2-N-(1-methylcyclohexa-2,4-dien-1-yl)benzene-1,2-diamine.
| Compound Name | 2-N-methyl-2-N-(1-methylcyclohexa-2,4-dien-1-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 175734127 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2-N-methyl-2-N-(1-methylcyclohexa-2,4-dien-1-yl)benzene-1,2-diamine |
| SMILES | CN(c1ccccc1N)C1(C)C=CC=CC1 |
| InChI | InChI=1S/C14H18N2/c1-14(10-6-3-7-11-14)16(2)13-9-5-4-8-12(13)15/h3-10H,11,15H2,1-2H3 |
| InChIKey | VWRDLJPPCKLYHT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|