C6H12N4O3Si — CID 175734878
4-propyl-6-trihydroxysilyl-1,3,5-triazin-2-amine (PubChem CID 175734878) has the molecular formula C6H12N4O3Si and a molecular weight of 216.27 g/mol. Its IUPAC name is 4-propyl-6-trihydroxysilyl-1,3,5-triazin-2-amine.
| Compound Name | 4-propyl-6-trihydroxysilyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 175734878 |
| Molecular Formula | C6H12N4O3Si |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-propyl-6-trihydroxysilyl-1,3,5-triazin-2-amine |
| SMILES | CCCc1nc(N)nc([Si](O)(O)O)n1 |
| InChI | InChI=1S/C6H12N4O3Si/c1-2-3-4-8-5(7)10-6(9-4)14(11,12)13/h11-13H,2-3H2,1H3,(H2,7,8,9,10) |
| InChIKey | ZNFGDECCVZEDFK-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|