C9H10O4S — CID 175736427
2-hydroxy-2-methyl-4-oxo-3-thiophen-2-ylbutanoic acid (PubChem CID 175736427) has the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-4-oxo-3-thiophen-2-ylbutanoic acid.
| Compound Name | 2-hydroxy-2-methyl-4-oxo-3-thiophen-2-ylbutanoic acid |
|---|---|
| PubChem CID | 175736427 |
| Molecular Formula | C9H10O4S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 2-hydroxy-2-methyl-4-oxo-3-thiophen-2-ylbutanoic acid |
| SMILES | CC(O)(C(=O)O)C(C=O)c1cccs1 |
| InChI | InChI=1S/C9H10O4S/c1-9(13,8(11)12)6(5-10)7-3-2-4-14-7/h2-6,13H,1H3,(H,11,12) |
| InChIKey | UTRZWCQDWCTRLF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|