About CID 175749396
CID 175749396 (PubChem CID 175749396) has the molecular formula C17H23LiNO4
and a molecular weight of 312.31 g/mol.
Molecular Properties
| Compound Name | CID 175749396 |
| PubChem CID | 175749396 |
| Molecular Formula | C17H23LiNO4 |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | — |
| SMILES | Cc1cccc(O[C@@H]2CCN(OC(=O)C3CCOCC3)C2)c1.[Li] |
| InChI | InChI=1S/C17H23NO4.Li/c1-13-3-2-4-15(11-13)21-16-5-8-18(12-16)22-17(19)14-6-9-20-10-7-14;/h2-4,11,14,16H,5-10,12H2,1H3;/t16-;/m1./s1 |
| InChIKey | LBJVRTPEBFJOED-PKLMIRHRSA-N |
| XLogP | 1.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 175749396 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175749396?
The IUPAC name of CID 175749396 (CID 175749396) is not available.
What is the SMILES notation for CID 175749396?
The canonical SMILES for CID 175749396 is Cc1cccc(O[C@@H]2CCN(OC(=O)C3CCOCC3)C2)c1.[Li].
What is the InChIKey of CID 175749396?
The InChIKey is LBJVRTPEBFJOED-PKLMIRHRSA-N. The full InChI is InChI=1S/C17H23NO4.Li/c1-13-3-2-4-15(11-13)21-16-5-8-18(12-16)22-17(19)14-6-9-20-10-7-14;/h2-4,11,14,16H,5-10,12H2,1H3;/t16-;/m1./s1.
What are the key properties of CID 175749396?
CID 175749396 has a molecular weight of 312.31 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175749396 is sourced from PubChem (CID 175749396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).