C17H23LiNO4 — CID 175749396
CID 175749396 (PubChem CID 175749396) has the molecular formula C17H23LiNO4 and a molecular weight of 312.31 g/mol.
| Compound Name | CID 175749396 |
|---|---|
| PubChem CID | 175749396 |
| Molecular Formula | C17H23LiNO4 |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | — |
| SMILES | Cc1cccc(O[C@@H]2CCN(OC(=O)C3CCOCC3)C2)c1.[Li] |
| InChI | InChI=1S/C17H23NO4.Li/c1-13-3-2-4-15(11-13)21-16-5-8-18(12-16)22-17(19)14-6-9-20-10-7-14;/h2-4,11,14,16H,5-10,12H2,1H3;/t16-;/m1./s1 |
| InChIKey | LBJVRTPEBFJOED-PKLMIRHRSA-N |
| XLogP | 1.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |