About (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane
(2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane (PubChem CID 175752214) has the molecular formula C14H23N3O3Se
and a molecular weight of 360.32 g/mol. Its IUPAC name is (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane.
Molecular Properties
| Compound Name | (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane |
| PubChem CID | 175752214 |
| Molecular Formula | C14H23N3O3Se |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane |
| SMILES | N.N[C@@H](CC[Se]CCC(=O)NCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O3Se.H3N/c15-12(14(18)19)6-8-20-9-7-13(17)16-10-11-4-2-1-3-5-11;/h1-5,12H,6-10,15H2,(H,16,17)(H,18,19);1H3/t12-;/m0./s1 |
| InChIKey | XFYXMERWRPFJPE-YDALLXLXSA-N |
| XLogP | 1.20 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane?
The IUPAC name of (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane (CID 175752214) is (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane.
What is the SMILES notation for (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane?
The canonical SMILES for (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane is N.N[C@@H](CC[Se]CCC(=O)NCc1ccccc1)C(=O)O.
What is the InChIKey of (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane?
The InChIKey is XFYXMERWRPFJPE-YDALLXLXSA-N. The full InChI is InChI=1S/C14H20N2O3Se.H3N/c15-12(14(18)19)6-8-20-9-7-13(17)16-10-11-4-2-1-3-5-11;/h1-5,12H,6-10,15H2,(H,16,17)(H,18,19);1H3/t12-;/m0./s1.
What are the key properties of (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane?
(2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane has a molecular weight of 360.32 g/mol, XLogP of 1.20, 9 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-[3-(benzylamino)-3-oxopropyl]selanylbutanoic acid;azane is sourced from PubChem (CID 175752214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).