C25H27NO4S — CID 175753865
(3R)-3-amino-1,1,1-tris(4-methoxyphenyl)-4-sulfanylbutan-2-one (PubChem CID 175753865) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is (3R)-3-amino-1,1,1-tris(4-methoxyphenyl)-4-sulfanylbutan-2-one.
| Compound Name | (3R)-3-amino-1,1,1-tris(4-methoxyphenyl)-4-sulfanylbutan-2-one |
|---|---|
| PubChem CID | 175753865 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (3R)-3-amino-1,1,1-tris(4-methoxyphenyl)-4-sulfanylbutan-2-one |
| SMILES | COc1ccc(C(C(=O)[C@@H](N)CS)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H27NO4S/c1-28-20-10-4-17(5-11-20)25(24(27)23(26)16-31,18-6-12-21(29-2)13-7-18)19-8-14-22(30-3)15-9-19/h4-15,23,31H,16,26H2,1-3H3/t23-/m0/s1 |
| InChIKey | LXLVSIVNUXGGPK-QHCPKHFHSA-N |
| XLogP | 3.87 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|