C33H39N3O7 — CID 175761234
tert-butyl 4-[[4-[(2S)-2-aminooxy-3-benzhydryloxy-3-oxopropoxy]benzoyl]amino]piperidine-1-carboxylate (PubChem CID 175761234) has the molecular formula C33H39N3O7 and a molecular weight of 589.69 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(2S)-2-aminooxy-3-benzhydryloxy-3-oxopropoxy]benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[(2S)-2-aminooxy-3-benzhydryloxy-3-oxopropoxy]benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175761234 |
| Molecular Formula | C33H39N3O7 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | tert-butyl 4-[[4-[(2S)-2-aminooxy-3-benzhydryloxy-3-oxopropoxy]benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2ccc(OC[C@H](ON)C(=O)OC(c3ccccc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C33H39N3O7/c1-33(2,3)42-32(39)36-20-18-26(19-21-36)35-30(37)25-14-16-27(17-15-25)40-22-28(43-34)31(38)41-29(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-17,26,28-29H,18-22,34H2,1-3H3,(H,35,37)/t28-/m0/s1 |
| InChIKey | LMUAZRPULRQXJL-NDEPHWFRSA-N |
| XLogP | 4.79 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|