C23H32F2N2O6 — CID 175771914
tert-butyl 6,6-difluoro-1-(2-hydroxy-3,3-dimethyl-4-oxo-4-phenylmethoxybutyl)-3,3a,5,6a-tetrahydropyrrolo[3,2-c][1,2]oxazole-4-carboxylate (PubChem CID 175771914) has the molecular formula C23H32F2N2O6 and a molecular weight of 470.51 g/mol. Its IUPAC name is tert-butyl 6,6-difluoro-1-(2-hydroxy-3,3-dimethyl-4-oxo-4-phenylmethoxybutyl)-3,3a,5,6a-tetrahydropyrrolo[3,2-c][1,2]oxazole-4-carboxylate.
| Compound Name | tert-butyl 6,6-difluoro-1-(2-hydroxy-3,3-dimethyl-4-oxo-4-phenylmethoxybutyl)-3,3a,5,6a-tetrahydropyrrolo[3,2-c][1,2]oxazole-4-carboxylate |
|---|---|
| PubChem CID | 175771914 |
| Molecular Formula | C23H32F2N2O6 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | tert-butyl 6,6-difluoro-1-(2-hydroxy-3,3-dimethyl-4-oxo-4-phenylmethoxybutyl)-3,3a,5,6a-tetrahydropyrrolo[3,2-c][1,2]oxazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)C2C1CON2CC(O)C(C)(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H32F2N2O6/c1-21(2,3)33-20(30)26-14-23(24,25)18-16(26)13-32-27(18)11-17(28)22(4,5)19(29)31-12-15-9-7-6-8-10-15/h6-10,16-18,28H,11-14H2,1-5H3 |
| InChIKey | OMBPUDYQDFETHE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |