C19H25F3N2O2 — CID 175771938
benzyl (3S)-4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-fluoro-2,2-dimethylbutanoate (PubChem CID 175771938) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is benzyl (3S)-4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-fluoro-2,2-dimethylbutanoate.
| Compound Name | benzyl (3S)-4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-fluoro-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 175771938 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | benzyl (3S)-4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-fluoro-2,2-dimethylbutanoate |
| SMILES | CC(C)(C(=O)OCc1ccccc1)[C@H](F)CN1CC[C@@H]2NCC(F)(F)[C@@H]21 |
| InChI | InChI=1S/C19H25F3N2O2/c1-18(2,17(25)26-11-13-6-4-3-5-7-13)15(20)10-24-9-8-14-16(24)19(21,22)12-23-14/h3-7,14-16,23H,8-12H2,1-2H3/t14-,15+,16+/m0/s1 |
| InChIKey | WTUPIPYFWMETTA-ARFHVFGLSA-N |
| XLogP | 2.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |