C9H10N4O2 — CID 175783191
(5R)-5-(aminomethyl)-5-pyridin-4-ylimidazolidine-2,4-dione (PubChem CID 175783191) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is (5R)-5-(aminomethyl)-5-pyridin-4-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(aminomethyl)-5-pyridin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 175783191 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (5R)-5-(aminomethyl)-5-pyridin-4-ylimidazolidine-2,4-dione |
| SMILES | NC[C@@]1(c2ccncc2)NC(=O)NC1=O |
| InChI | InChI=1S/C9H10N4O2/c10-5-9(6-1-3-11-4-2-6)7(14)12-8(15)13-9/h1-4H,5,10H2,(H2,12,13,14,15)/t9-/m0/s1 |
| InChIKey | KMNATTWBPBLKIU-VIFPVBQESA-N |
| XLogP | -0.93 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|