C20H31N5O2S — CID 175794607
butyl 4-[(2S)-2-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]propyl]piperazine-1-carboxylate (PubChem CID 175794607) has the molecular formula C20H31N5O2S and a molecular weight of 405.57 g/mol. Its IUPAC name is butyl 4-[(2S)-2-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]propyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[(2S)-2-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175794607 |
| Molecular Formula | C20H31N5O2S |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | butyl 4-[(2S)-2-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]propyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C[C@H](C)Nc2nc(C)nc3c(C)csc23)CC1 |
| InChI | InChI=1S/C20H31N5O2S/c1-5-6-11-27-20(26)25-9-7-24(8-10-25)12-15(3)21-19-18-17(14(2)13-28-18)22-16(4)23-19/h13,15H,5-12H2,1-4H3,(H,21,22,23)/t15-/m0/s1 |
| InChIKey | NSDNWGSMJPKQDD-HNNXBMFYSA-N |
| XLogP | 3.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|