C37H34BrN3O7S2 — CID 175795347
[3-[[2-[4-[(3-bromothiophene-2-carbonyl)amino]piperidin-1-yl]phenyl]-(2-phenylethyl)sulfamoyl]-5-methylbenzoyl] furan-2-carboxylate (PubChem CID 175795347) has the molecular formula C37H34BrN3O7S2 and a molecular weight of 776.73 g/mol. Its IUPAC name is [3-[[2-[4-[(3-bromothiophene-2-carbonyl)amino]piperidin-1-yl]phenyl]-(2-phenylethyl)sulfamoyl]-5-methylbenzoyl] furan-2-carboxylate.
| Compound Name | [3-[[2-[4-[(3-bromothiophene-2-carbonyl)amino]piperidin-1-yl]phenyl]-(2-phenylethyl)sulfamoyl]-5-methylbenzoyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 175795347 |
| Molecular Formula | C37H34BrN3O7S2 |
| Molecular Weight | 776.73 g/mol |
| Exact Mass | 775.10 |
| IUPAC Name | [3-[[2-[4-[(3-bromothiophene-2-carbonyl)amino]piperidin-1-yl]phenyl]-(2-phenylethyl)sulfamoyl]-5-methylbenzoyl] furan-2-carboxylate |
| SMILES | Cc1cc(C(=O)OC(=O)c2ccco2)cc(S(=O)(=O)N(CCc2ccccc2)c2ccccc2N2CCC(NC(=O)c3sccc3Br)CC2)c1 |
| InChI | InChI=1S/C37H34BrN3O7S2/c1-25-22-27(36(43)48-37(44)33-12-7-20-47-33)24-29(23-25)50(45,46)41(19-13-26-8-3-2-4-9-26)32-11-6-5-10-31(32)40-17-14-28(15-18-40)39-35(42)34-30(38)16-21-49-34/h2-12,16,20-24,28H,13-15,17-19H2,1H3,(H,39,42) |
| InChIKey | VAHHSGCZZHEHFX-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.73 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|