C9H14N4O2 — CID 175797222
5-methyl-2-(triazol-1-yl)piperidine-1-carboxylic acid (PubChem CID 175797222) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-methyl-2-(triazol-1-yl)piperidine-1-carboxylic acid.
| Compound Name | 5-methyl-2-(triazol-1-yl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175797222 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 5-methyl-2-(triazol-1-yl)piperidine-1-carboxylic acid |
| SMILES | CC1CCC(n2ccnn2)N(C(=O)O)C1 |
| InChI | InChI=1S/C9H14N4O2/c1-7-2-3-8(12(6-7)9(14)15)13-5-4-10-11-13/h4-5,7-8H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | YPEMNTLXVGROLJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |