C26H35FN4O6S2 — CID 175797451
butyl 7-[2-[[4-(dimethylsulfamoyl)phenyl]sulfonylamino]-6-fluorophenyl]-1,7-diazaspiro[3.5]nonane-1-carboxylate (PubChem CID 175797451) has the molecular formula C26H35FN4O6S2 and a molecular weight of 582.72 g/mol. Its IUPAC name is butyl 7-[2-[[4-(dimethylsulfamoyl)phenyl]sulfonylamino]-6-fluorophenyl]-1,7-diazaspiro[3.5]nonane-1-carboxylate.
| Compound Name | butyl 7-[2-[[4-(dimethylsulfamoyl)phenyl]sulfonylamino]-6-fluorophenyl]-1,7-diazaspiro[3.5]nonane-1-carboxylate |
|---|---|
| PubChem CID | 175797451 |
| Molecular Formula | C26H35FN4O6S2 |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | butyl 7-[2-[[4-(dimethylsulfamoyl)phenyl]sulfonylamino]-6-fluorophenyl]-1,7-diazaspiro[3.5]nonane-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC12CCN(c1c(F)cccc1NS(=O)(=O)c1ccc(S(=O)(=O)N(C)C)cc1)CC2 |
| InChI | InChI=1S/C26H35FN4O6S2/c1-4-5-19-37-25(32)31-18-15-26(31)13-16-30(17-14-26)24-22(27)7-6-8-23(24)28-38(33,34)20-9-11-21(12-10-20)39(35,36)29(2)3/h6-12,28H,4-5,13-19H2,1-3H3 |
| InChIKey | MLSJXSOXWUFJOB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|